Tris(4-formylphenyl)amine structure
|
Common Name | Tris(4-formylphenyl)amine | ||
|---|---|---|---|---|
| CAS Number | 119001-43-3 | Molecular Weight | 329.349 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 551.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C21H15NO3 | Melting Point | 244-248ºC | |
| MSDS | Chinese USA | Flash Point | 257.3±21.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Tris(4-formylphenyl)amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 551.1±45.0 °C at 760 mmHg |
| Melting Point | 244-248ºC |
| Molecular Formula | C21H15NO3 |
| Molecular Weight | 329.349 |
| Flash Point | 257.3±21.1 °C |
| Exact Mass | 329.105194 |
| PSA | 54.45000 |
| LogP | 4.19 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.714 |
| InChIKey | YOXHQRNDWBRUOL-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(N(c2ccc(C=O)cc2)c2ccc(C=O)cc2)cc1 |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis , 3736, (2007)
|
| 4-(4-formyl-N-(4-formylphenyl)anilino)benzaldehyde |
| 4,4',4''-Nitrilotribenzaldehyde |
| Benzaldehyde, 4,4',4''-nitrilotris- |
| Tris(4-formylphenyl)amine |
| MFCD08276437 |