2-((tert-Butoxycarbonyl)amino)pent-4-enoic acid structure
|
Common Name | 2-((tert-Butoxycarbonyl)amino)pent-4-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 119479-32-2 | Molecular Weight | 215.246 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 352.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C10H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.7±25.9 °C | |
| Name | 2-((tert-Butoxycarbonyl)amino)pent-4-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.0±35.0 °C at 760 mmHg |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.246 |
| Flash Point | 166.7±25.9 °C |
| Exact Mass | 215.115753 |
| PSA | 79.12000 |
| LogP | 2.04 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.473 |
| InChIKey | BUPDPLXLAKNJMI-UHFFFAOYSA-N |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924199090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
| 4-Pentenoic acid, 2-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| 2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-pentenoic acid |
| DL-Boc-Allylglycine |