2-(p-Tolyl)-1H-benzo[d]imidazole structure
|
Common Name | 2-(p-Tolyl)-1H-benzo[d]imidazole | ||
|---|---|---|---|---|
| CAS Number | 120-03-6 | Molecular Weight | 208.25800 | |
| Density | 1.178g/cm3 | Boiling Point | 402.3ºC at 760mmHg | |
| Molecular Formula | C14H12N2 | Melting Point | 265-269 °C | |
| MSDS | N/A | Flash Point | 210.1ºC | |
| Name | 2-(4-Methylphenyl)benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.178g/cm3 |
|---|---|
| Boiling Point | 402.3ºC at 760mmHg |
| Melting Point | 265-269 °C |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.25800 |
| Flash Point | 210.1ºC |
| Exact Mass | 208.10000 |
| PSA | 28.68000 |
| LogP | 3.53830 |
| Vapour Pressure | 1.11E-06mmHg at 25°C |
| Index of Refraction | 1.67 |
| InChIKey | YJSWQFYMPODDTQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2nc3ccccc3[nH]2)cc1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00209485 |
| 2-(4-methylphenyl)-1h-benzimidazole |