1,2-Di-O-acetyl-3-azido-3-deoxy-5-O-(4-methyl)benzoyl-D-ribofuranose structure
|
Common Name | 1,2-Di-O-acetyl-3-azido-3-deoxy-5-O-(4-methyl)benzoyl-D-ribofuranose | ||
|---|---|---|---|---|
| CAS Number | 120143-22-8 | Molecular Weight | 377.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19N3O7 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 1,2-Di-O-acetyl-3-azido-3-deoxy-5-O-(4-methyl)benzoyl-D-ribofuranose1,2-Di-O-acetyl-3-azido-3-deoxy-5-O-(4-methyl)benzoyl-D-ribofuranose is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
| Name | 1,2-di-o-acetyl-3-azido-3-deoxy-5-o-toluoyl-d-ribofuranose |
|---|---|
| Synonym | More Synonyms |
| Description | 1,2-Di-O-acetyl-3-azido-3-deoxy-5-O-(4-methyl)benzoyl-D-ribofuranose is a purine nucleoside analog. Purine nucleoside analogs have broad antitumor activity targeting indolent lymphoid malignancies. Anticancer mechanisms in this process rely on inhibition of DNA synthesis, induction of apoptosis, etc[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H19N3O7 |
|---|---|
| Molecular Weight | 377.35 |
| Exact Mass | 377.12200 |
| PSA | 137.88000 |
| LogP | 1.50316 |
| InChIKey | WLSQDUZXMHIZCA-BOEXNKMNSA-N |
| SMILES | CC(=O)OC1OC(COC(=O)c2ccccc2C)C(N=[N+]=[N-])C1OC(C)=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RIDADR | NONH for all modes of transport |
| 3-azido-1,2-bis-O-acetyl-5-O-toluoyl-3-deoxy-D-ribofuranose |
| 3-Azido-1H-[1,2,4]triazol |
| 1H-1,2,4-Triazole,3-azido |
| 3-Azido-1,2,4-triazol |
| 3-azido-1H-[1,2,4]triazole |
| 3-Azido-1,2,4-triazole |
| 3-azido-1,2-di-O-acetyl-5-O-(p-toluoyl)-3-deoxy-D-ribofuranose |