4-benzyloxyphenyl magnesium bromide structure
|
Common Name | 4-benzyloxyphenyl magnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 120186-59-6 | Molecular Weight | 287.43500 | |
| Density | 1.033 g/mL at 25ºC | Boiling Point | N/A | |
| Molecular Formula | C13H11BrMgO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -20ºC | |
| Name | magnesium,phenylmethoxybenzene,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.033 g/mL at 25ºC |
|---|---|
| Molecular Formula | C13H11BrMgO |
| Molecular Weight | 287.43500 |
| Flash Point | -20ºC |
| Exact Mass | 285.98400 |
| PSA | 9.23000 |
| LogP | 3.91140 |
| Appearance of Characters | Liquid | Clear colorless to brown |
| InChIKey | VMPINCGEFWWFMA-UHFFFAOYSA-M |
| SMILES | [Br-].[Mg+2].[c-]1ccc(OCc2ccccc2)cc1 |
| Hazard Codes | F: Flammable;C: Corrosive; |
|---|---|
| Risk Phrases | R11 |
| Safety Phrases | S16 |
| RIDADR | UN 2924 3/PG 2 |
|
~%
4-benzyloxyphen... CAS#:120186-59-6 |
| Literature: Barvian, Kevin K; Carpenter, Andrew J; Cooper, Joel P; Feldman, Paul L; Garrido, Dulce M; Guo, Yu C; Handlon, Anthony L; Hertzog, Donald L; Hyman, Clifton E; Peat, Andrew J; Peckham, Gregory E; Speake, Jason D; Swain, William R; Tavares, Francis X; Zhou, Huiqiang J Patent: US2006/194871 A1, 2006 ; Location in patent: Page/Page column 47 ; US 20060194871 A1 |
| p-benzyloxyphenyl magnesium bromide |
| (4-Benzyloxy)phenylmagnesiumbromid |
| 4-Benzyloxyphenylmagnesium bromide solution |
| 4-Benzyloxyphenylmagnesium bromide |
| 4-BENZYLOXYPHENYL MAGNESIUM BROMIDE |
| 4-benzyloxy-phenyl magnesium bromide |