Quinoline,4,5,8-trichloro-2-methyl- structure
|
Common Name | Quinoline,4,5,8-trichloro-2-methyl- | ||
|---|---|---|---|---|
| CAS Number | 1203-36-7 | Molecular Weight | 246.52000 | |
| Density | 1.459g/cm3 | Boiling Point | 331.7ºC at 760mmHg | |
| Molecular Formula | C10H6Cl3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.5ºC | |
| Name | 4,5,8-trichloro-2-methylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.459g/cm3 |
|---|---|
| Boiling Point | 331.7ºC at 760mmHg |
| Molecular Formula | C10H6Cl3N |
| Molecular Weight | 246.52000 |
| Flash Point | 184.5ºC |
| Exact Mass | 244.95700 |
| PSA | 12.89000 |
| LogP | 4.50340 |
| Vapour Pressure | 0.000296mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | POBBQROTQXLRNH-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c2c(Cl)ccc(Cl)c2n1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-4,5,8-trichloroquinoline |
| 4,5,8-Trichloroquinaldine |
| 4,5,8-trichloro-2-methyl-quinoline |
| 4,5,8-Trichlor-chinaldin |
| QU145 |