Epitinib structure
|
Common Name | Epitinib | ||
|---|---|---|---|---|
| CAS Number | 1203902-67-3 | Molecular Weight | 430.50 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EpitinibEpitinib is an orally active and selective epidermal growth factor receptor tyrosine kinase inhibitor (EGFR-TKI) designed for optimal brain penetration. Epitinib can be used for the research of cancer[1][2]. |
| Name | Epitinib |
|---|
| Description | Epitinib is an orally active and selective epidermal growth factor receptor tyrosine kinase inhibitor (EGFR-TKI) designed for optimal brain penetration. Epitinib can be used for the research of cancer[1][2]. |
|---|---|
| Related Catalog | |
| Target |
EGFR[2] |
| References |
| Molecular Formula | C24H26N6O2 |
|---|---|
| Molecular Weight | 430.50 |
| InChIKey | DQAZPZIYEOGZAF-UHFFFAOYSA-N |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(NC(=O)N4CCN(CC)CC4)cc23)c1 |