Epitinib succinate structure
|
Common Name | Epitinib succinate | ||
|---|---|---|---|---|
| CAS Number | 2252334-12-4 | Molecular Weight | 548.59 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H32N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Epitinib succinateEpitinib succinate is an orally active and selective epidermal growth factor receptor tyrosine kinase inhibitor (EGFR-TKI) designed for optimal brain penetration. Epitinib succinate can be used for the research of cancer[1][2]. |
| Name | Epitinib succinate |
|---|
| Description | Epitinib succinate is an orally active and selective epidermal growth factor receptor tyrosine kinase inhibitor (EGFR-TKI) designed for optimal brain penetration. Epitinib succinate can be used for the research of cancer[1][2]. |
|---|---|
| Related Catalog | |
| Target |
EGFR[2] |
| In Vitro | Epitinib succinate is an orally active and selective epidermal growth factor receptor tyrosine kinase inhibitor (EGFR-TKI) designed for optimal brain penetration[1][2]. |
| References |
| Molecular Formula | C28H32N6O6 |
|---|---|
| Molecular Weight | 548.59 |
| InChIKey | HISXHQFAOANCJX-UHFFFAOYSA-N |
| SMILES | C#Cc1cccc(Nc2ncnc3cc(OC)c(NC(=O)N4CCN(CC)CC4)cc23)c1.O=C(O)CCC(=O)O |