methyl 3-chloro-4-hydroxy-5-methoxybenzoate structure
|
Common Name | methyl 3-chloro-4-hydroxy-5-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 1205-50-1 | Molecular Weight | 216.61800 | |
| Density | 1.339g/cm3 | Boiling Point | 319.9ºC at 760mmHg | |
| Molecular Formula | C9H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.3ºC | |
| Name | methyl 3-chloro-4-hydroxy-5-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 319.9ºC at 760mmHg |
| Molecular Formula | C9H9ClO4 |
| Molecular Weight | 216.61800 |
| Flash Point | 147.3ºC |
| Exact Mass | 216.01900 |
| PSA | 55.76000 |
| LogP | 1.84080 |
| Vapour Pressure | 0.000176mmHg at 25°C |
| Index of Refraction | 1.549 |
| InChIKey | ONPNTTNXLNYIJM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)c(O)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
methyl 3-chloro... CAS#:1205-50-1 |
| Literature: Pearl; Beyer Journal of the American Chemical Society, 1949 , vol. 71, p. 1066 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Chlor-4-hydroxy-5-methoxy-benzoesaeure-methylester |
| 5-Chlor-4-hydroxy-3-methoxy-benzoesaeure-methylester |
| EINECS 214-884-2 |
| 3-Chloro-4-hydroxy-5-methoxy-benzoic acid methyl ester |