5-[2-(4'-Methylbiphenyl)]tetrazole structure
|
Common Name | 5-[2-(4'-Methylbiphenyl)]tetrazole | ||
|---|---|---|---|---|
| CAS Number | 120568-11-8 | Molecular Weight | 236.272 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 458.4±48.0 °C at 760 mmHg | |
| Molecular Formula | C14H12N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.5±22.5 °C | |
Use of 5-[2-(4'-Methylbiphenyl)]tetrazoleLosartan potassium impurity E is a Valsartan impurity. |
| Name | 5-(4'-Methyl-2-biphenylyl)-1H-tetrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.4±48.0 °C at 760 mmHg |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.272 |
| Flash Point | 214.5±22.5 °C |
| Exact Mass | 236.106201 |
| PSA | 54.46000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | VWOJMXKARYCRCC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| 5-[2-(4-methylphenyl)phenyl]-2H-tetrazole |
| Methylbiphenyl Tetrazole |
| 5-(4'-Methyl-2-biphenylyl)-1H-tetrazole |
| 5-(4'-methyl-[1,1'-biphenyl]-2-yl)-1H-tetrazole |
| 1H-Tetrazole, 5-(4'-methyl[1,1'-biphenyl]-2-yl)- |
| 5-[2-(4'-Methylbiphenyl)]tetrazole |
| Valsartan Impurity 9 |