2-aziridinyl-5-hydroxy-1,4-naphthoquinone structure
|
Common Name | 2-aziridinyl-5-hydroxy-1,4-naphthoquinone | ||
|---|---|---|---|---|
| CAS Number | 120618-66-8 | Molecular Weight | 215.20500 | |
| Density | 1.571g/cm3 | Boiling Point | 431.4ºC at 760mmHg | |
| Molecular Formula | C12H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.7ºC | |
| Name | 2-(aziridin-1-yl)-5-hydroxynaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.571g/cm3 |
|---|---|
| Boiling Point | 431.4ºC at 760mmHg |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.20500 |
| Flash Point | 214.7ºC |
| Exact Mass | 215.05800 |
| PSA | 57.38000 |
| LogP | 0.90860 |
| Vapour Pressure | 4.75E-08mmHg at 25°C |
| Index of Refraction | 1.746 |
| InChIKey | WXPLAUSTEMHFNE-UHFFFAOYSA-N |
| SMILES | O=C1C(N2CC2)=CC(=O)c2c(O)cccc21 |
|
~44%
2-aziridinyl-5-... CAS#:120618-66-8 |
| Literature: Lin; Xu; Zhu; Cosby; Sartorelli Journal of Medicinal Chemistry, 1989 , vol. 32, # 7 p. 1467 - 1471 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| 2-aziridinyl-5-hydroxy-1,4-naphthoquinone |
| 2-Azhnq |