2-aziridinyl-1,4-naphthoquinon-5-yl 4-ethylbenzenesulfonate structure
|
Common Name | 2-aziridinyl-1,4-naphthoquinon-5-yl 4-ethylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 133041-99-3 | Molecular Weight | 383.41800 | |
| Density | 1.446g/cm3 | Boiling Point | 593.3ºC at 760mmHg | |
| Molecular Formula | C20H17NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 312.6ºC | |
| Name | [6-(aziridin-1-yl)-5,8-dioxonaphthalen-1-yl] 4-ethylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446g/cm3 |
|---|---|
| Boiling Point | 593.3ºC at 760mmHg |
| Molecular Formula | C20H17NO5S |
| Molecular Weight | 383.41800 |
| Flash Point | 312.6ºC |
| Exact Mass | 383.08300 |
| PSA | 88.90000 |
| LogP | 3.61390 |
| Vapour Pressure | 4.8E-14mmHg at 25°C |
| Index of Refraction | 1.668 |
| InChIKey | XQYMEAHEGCAQLN-UHFFFAOYSA-N |
| SMILES | CCc1ccc(S(=O)(=O)Oc2cccc3c2C(=O)C=C(N2CC2)C3=O)cc1 |
|
~%
2-aziridinyl-1,... CAS#:133041-99-3 |
| Literature: Lin; Zhu; Xu; Divo; Sartorelli Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1634 - 1639 |
|
~%
2-aziridinyl-1,... CAS#:133041-99-3 |
| Literature: Lin; Zhu; Xu; Divo; Sartorelli Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1634 - 1639 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Aziridinyl-1,4-naphthoquinon-5-yl 4-ethylbenzenesulfonate |
| 2-Anqeb |