Lofexidine-d4 hydrochloride structure
|
Common Name | Lofexidine-d4 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1206845-57-9 | Molecular Weight | 299.62 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9D4Cl3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lofexidine-d4 hydrochlorideLofexidine-d4 hydrochloride (Baq-168-d4) is the deuterium labeled Lofexidine hydrochloride. Lofexidine hydrochloride is a selective α2-receptor agonist, commonly used to alleviate the physical symptoms of heroin and other types of opioid withdrawal[1][2]. |
| Name | Lofexidine-d4 hydrochloride |
|---|
| Description | Lofexidine-d4 hydrochloride (Baq-168-d4) is the deuterium labeled Lofexidine hydrochloride. Lofexidine hydrochloride is a selective α2-receptor agonist, commonly used to alleviate the physical symptoms of heroin and other types of opioid withdrawal[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C11H9D4Cl3N2O |
|---|---|
| Molecular Weight | 299.62 |
| InChIKey | CZGIWEABEALYSI-NZLXMSDQSA-N |
| SMILES | CC(C1=NCCN1)c1c(Cl)cccc1Cl |