IEM-1460 structure
|
Common Name | IEM-1460 | ||
|---|---|---|---|---|
| CAS Number | 121034-89-7 | Molecular Weight | 454.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H38Br2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IEM-1460IEM-1460 blocks both AMPA and NMDA glutamate receptor with anticonvulsant effect in vivo[1]. |
| Name | 5-(1-adamantylmethylamino)pentyl-trimethylazanium,bromide,hydrobromide |
|---|---|
| Synonym | More Synonyms |
| Description | IEM-1460 blocks both AMPA and NMDA glutamate receptor with anticonvulsant effect in vivo[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H38Br2N2 |
|---|---|
| Molecular Weight | 454.33 |
| Exact Mass | 452.140167 |
| PSA | 12.03000 |
| LogP | 2.02190 |
| InChIKey | CQTDZUSQSTUZDA-UHFFFAOYSA-M |
| SMILES | Br.C[N+](C)(C)CCCCCNCC12CC3CC(CC(C3)C1)C2.[Br-] |
| 5-[(Adamantan-1-ylmethyl)amino]-N,N,N-trimethyl-1-pentanaminium bromide hydrobromide (1:1:1) |
| 1-Pentanaminium, N,N,N-trimethyl-5-[(tricyclo[3.3.1.1]dec-1-ylmethyl)amino]-, bromide, hydrobromide (1:1:1) |
| 5-[(Adamantan-1-ylmethyl)amino]-N,N,N-trimethylpentan-1-aminium bromide hydrobromide (1:1:1) |
| Iem 1460 |
| Tocris-1636 |