Phenazine, 2-chloro-,5-oxide structure
|
Common Name | Phenazine, 2-chloro-,5-oxide | ||
|---|---|---|---|---|
| CAS Number | 1211-09-2 | Molecular Weight | 230.65000 | |
| Density | 1.42g/cm3 | Boiling Point | 435.1ºC at 760mmHg | |
| Molecular Formula | C12H7ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.9ºC | |
| Name | 2-Chlorophenazine 5-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 435.1ºC at 760mmHg |
| Molecular Formula | C12H7ClN2O |
| Molecular Weight | 230.65000 |
| Flash Point | 216.9ºC |
| Exact Mass | 230.02500 |
| PSA | 38.35000 |
| LogP | 3.46990 |
| Vapour Pressure | 2.29E-07mmHg at 25°C |
| Index of Refraction | 1.698 |
| InChIKey | BKCPNDKKVXMVHG-UHFFFAOYSA-N |
| SMILES | [O-][n+]1c2ccccc2nc2cc(Cl)ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-chloro-5-oxidophenazin-5-ium |