Methyl (2-pent-2-enyl-3-oxo-1-cyclopentyl)acetate structure
|
Common Name | Methyl (2-pent-2-enyl-3-oxo-1-cyclopentyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 1211-29-6 | Molecular Weight | 224.296 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 302.9±15.0 °C at 760 mmHg | |
| Molecular Formula | C13H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.6±20.4 °C | |
Use of Methyl (2-pent-2-enyl-3-oxo-1-cyclopentyl)acetateMethyl jasmonate is a phytohormone involved in plant defenses under stress conditions. Methyl jasmonate can improve antioxidant properties of blueberry leaf extracts (mainly anthocyanins), and decrease the viability and migration capacity of AGS cells. Anticarcinogenic activity[1]. |
| Name | (-)-methyl jasmonate |
|---|---|
| Synonym | More Synonyms |
| Description | Methyl jasmonate is a phytohormone involved in plant defenses under stress conditions. Methyl jasmonate can improve antioxidant properties of blueberry leaf extracts (mainly anthocyanins), and decrease the viability and migration capacity of AGS cells. Anticarcinogenic activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Methyl jasmonate-treated blueberry leaf extraction (10-3200 μg/mL; 1 hour) can decrease cell viability of AGS cells with increasing dose[1]. Methyl jasmonate-treated blueberry leaf extraction (10-3200 μg/mL) can significantly decrease the expression of p-P70S6K (AKT/mTOR pathway) and p-ERK1/2 (MAPK) proteins[1]. Cell Viability Assay Cell Line: Gastric cancer cells (line AGS)[1] Concentration: 10, 25, 50, 100, 200, 400, 800, 1600 and 3200 μg/mL Incubation Time: 1 hour Result: Cell viability of AGS cells gradually decreased in response to increasing doses of blueberry leaf extract from MeJA treated plants. Western Blot Analysis Cell Line: AGS cells[1] Concentration: 10, 50, 100, 200, 400, 800, 1600 and 3200 μg/mL Incubation Time: Result: Blueberry leaf extracts of MeJA-treated plants significantly decreased the expression of p-P70S6K (AKT/mTOR pathway) and p-ERK1/2 (MAPK) proteins. |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 302.9±15.0 °C at 760 mmHg |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.296 |
| Flash Point | 128.6±20.4 °C |
| Exact Mass | 224.141251 |
| PSA | 43.37000 |
| LogP | 2.12 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | GEWDNTWNSAZUDX-WQMVXFAESA-N |
| SMILES | CCC=CCC1C(=O)CCC1CC(=O)OC |
| WGK Germany | 3 |
|---|---|
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (3-Oxo-2-(2-pentenyl)-1-cyclopentyl)acetic acid methyl ester |
| (-)-METHYL JASMONATE |
| JASMONICACIDMETHYLESTER |
| EINECS 214-918-6 |
| Methyl-[3-oxo-2-(pent-2-en-1-yl)cyclopentyl]acetat |
| Methyl [3-oxo-2-(2-penten-1-yl)cyclopentyl]acetate |
| Cyclopentaneacetic acid, 3-oxo-2-(2-penten-1-yl)-, methyl ester |
| Methyl jasmonate |
| METHYL (+/-)-JASMONATE |
| Methyl (2-pent-2-enyl-3-oxo-1-cyclopentyl)acetate |
| Methyl 2-((1R,2R)-3-oxo-2-((Z)-pent-2-en-1-yl)cyclopentyl)acetate |
| CYCLOPENTANEACETICACID, 3-OXO-2-(2Z)-2-PENTEN-1-YL-, METHYL ESTER, (1R,2R)- |
| MFCD00151382 |
| JASMONIC ACID METHYL ESTER |
| Methyl [3-oxo-2-(pent-2-en-1-yl)cyclopentyl]acetate |