[Dimethoxy(methyl)silyl]methyl methacrylate structure
|
Common Name | [Dimethoxy(methyl)silyl]methyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 121177-93-3 | Molecular Weight | 204.296 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 198.8±23.0 °C at 760 mmHg | |
| Molecular Formula | C8H16O4Si | Melting Point | <-100ºC | |
| MSDS | N/A | Flash Point | 61.6±18.2 °C | |
| Name | (Dimethoxy(methyl)silyl)methyl methacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 198.8±23.0 °C at 760 mmHg |
| Melting Point | <-100ºC |
| Molecular Formula | C8H16O4Si |
| Molecular Weight | 204.296 |
| Flash Point | 61.6±18.2 °C |
| Exact Mass | 204.081787 |
| PSA | 44.76000 |
| LogP | 0.82 |
| Vapour Pressure | 0.4±0.4 mmHg at 25°C |
| Index of Refraction | 1.422 |
| InChIKey | YBUIRAZOPRQNDE-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OC[Si](C)(OC)OC |
| Storage condition | below 5° C |
|
~%
[Dimethoxy(meth... CAS#:121177-93-3 |
| Literature: Monatshefte fur Chemie, , vol. 134, # 8 p. 1081 - 1092 |
|
~%
[Dimethoxy(meth... CAS#:121177-93-3 |
| Literature: US2004/171859 A1, ; Page 4-5 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| [Dimethoxy(methyl)silyl]methyl methacrylate |
| [dimethoxy(methyl)silyl]methyl 2-methylprop-2-enoate |
| 2-Propenoic acid, 2-methyl-, (dimethoxymethylsilyl)methyl ester |