H-LYS-ARG-THR-LEU-ARG-ARG-OH structure
|
Common Name | H-LYS-ARG-THR-LEU-ARG-ARG-OH | ||
|---|---|---|---|---|
| CAS Number | 121284-21-7 | Molecular Weight | 829.00600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H68N16O8 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of H-LYS-ARG-THR-LEU-ARG-ARG-OHLys-Arg-Thr-Leu-Arg-Arg (KRTLRR) is a hexapeptide. Lys-Arg-Thr-Leu-Arg-Arg is a substrate of protein kinase C from EGF receptor. Lys-Arg-Thr-Leu-Arg-Arg can be used to determine the activity of protein kinase C[1]. |
| Name | 2-[[2-[[2-[[2-[[2-(2,6-diaminohexanoylamino)-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Lys-Arg-Thr-Leu-Arg-Arg (KRTLRR) is a hexapeptide. Lys-Arg-Thr-Leu-Arg-Arg is a substrate of protein kinase C from EGF receptor. Lys-Arg-Thr-Leu-Arg-Arg can be used to determine the activity of protein kinase C[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Lys-Arg-Thr-Leu-Arg-Arg (KRTLRR; 0.5 mg/mL; 20 min; WI-38 fibroblasts) increases the activity of a membrane-bound Ca2+-inhibited protein kinase and induces autophosphorylation to determine the activity of protein kinase C[1]. |
| Molecular Formula | C34H68N16O8 |
|---|---|
| Molecular Weight | 829.00600 |
| Exact Mass | 828.54100 |
| PSA | 440.77000 |
| LogP | 2.09590 |
| InChIKey | QUJRRXNRGVULBH-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C(CCCN=C(N)N)NC(=O)C(N)CCCCN)C(C)O)C(=O)NC(CCCN=C(N)N)C(=O)NC(CCCN=C(N)N)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Lys-Arg-Thr-Leu-Arg-Arg trifluoroacetate salt |