AR-AO 14418-d3 structure
|
Common Name | AR-AO 14418-d3 | ||
|---|---|---|---|---|
| CAS Number | 1216908-63-2 | Molecular Weight | 308.31308 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of AR-AO 14418-d3AR-A014418-d3 (AR 0133418-d3) is the deuterium labeled AR-A014418. AR-A014418 is a potent, selective, and ATP-competitive GSK3β inhibitor (IC50=104 nM; Ki=38 nM)[1]. |
| Name | AR-AO 14418-d3 |
|---|
| Description | AR-A014418-d3 (AR 0133418-d3) is the deuterium labeled AR-A014418. AR-A014418 is a potent, selective, and ATP-competitive GSK3β inhibitor (IC50=104 nM; Ki=38 nM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H12N4O4S |
|---|---|
| Molecular Weight | 308.31308 |
| InChIKey | YAEMHJKFIIIULI-FIBGUPNXSA-N |
| SMILES | COc1ccc(CNC(=O)Nc2ncc([N+](=O)[O-])s2)cc1 |
| Storage condition | 2-8°C |