Lovastatin-d3 hydroxy acid sodium structure
|
Common Name | Lovastatin-d3 hydroxy acid sodium | ||
|---|---|---|---|---|
| CAS Number | 1217528-38-5 | Molecular Weight | 447.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H35D3NaO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lovastatin-d3 hydroxy acid sodiumLovastatin-d3 hydroxy acid (Mevinolinic acid-d3) sodium is the deuterium labeled Lovastatin hydroxy acid sodium. Lovastatin hydroxy acid sodium (Mevinolinic acid sodium) is a highly potent inhibitor of HMG-CoA reductase with a Ki of 0.6 nM[1]. |
| Name | Lovastatin-d3 hydroxy acid sodium |
|---|
| Description | Lovastatin-d3 hydroxy acid (Mevinolinic acid-d3) sodium is the deuterium labeled Lovastatin hydroxy acid sodium. Lovastatin hydroxy acid sodium (Mevinolinic acid sodium) is a highly potent inhibitor of HMG-CoA reductase with a Ki of 0.6 nM[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C24H35D3NaO6 |
|---|---|
| Molecular Weight | 447.56 |
| InChIKey | LXZBFUBRYYVRQJ-QRVNCVFZSA-M |
| SMILES | CCC(C)C(=O)OC1CC(C)C=C2C=CC(C)C(CCC(O)CC(O)CC(=O)[O-])C21.[Na+] |