1-amino-4-(methylamino)anthraquinone structure
|
Common Name | 1-amino-4-(methylamino)anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 1220-94-6 | Molecular Weight | 252.26800 | |
| Density | 1.395 g/cm3 | Boiling Point | 534.5ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.1ºC | |
| Name | 1-amino-4-(methylamino)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.395 g/cm3 |
|---|---|
| Boiling Point | 534.5ºC at 760 mmHg |
| Molecular Formula | C15H12N2O2 |
| Molecular Weight | 252.26800 |
| Flash Point | 277.1ºC |
| Exact Mass | 252.09000 |
| PSA | 72.19000 |
| LogP | 2.74010 |
| Vapour Pressure | 1.67E-11mmHg at 25°C |
| Index of Refraction | 1.734 |
| InChIKey | ICVRBKCRXNVOJC-UHFFFAOYSA-N |
| SMILES | CNc1ccc(N)c2c1C(=O)c1ccccc1C2=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2922399090 |
|---|
|
~65%
1-amino-4-(meth... CAS#:1220-94-6 |
| Literature: Studzinskii, O. P.; El'tsov, A. V. J. Gen. Chem. USSR (Engl. Transl.), 1980 , vol. 50, # 11 p. 2575 - 2581,2086 - 2091 |
|
~39%
1-amino-4-(meth... CAS#:1220-94-6 |
| Literature: Yoshida, Katsuhira; Matsuoka, Masaru; Yamashita, Yoshio; Nagamori, Shoichi; Kitao, Teijiro Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 12 p. 3725 - 3726 |
|
~%
1-amino-4-(meth... CAS#:1220-94-6 |
| Literature: CIBA Patent: DE591170 , 1933 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 20, p. 1345 |
|
~%
1-amino-4-(meth... CAS#:1220-94-6 |
| Literature: Naiki Yuki Gosei Kagaku Kyokaishi, 1954 , vol. 12, p. 401,403 Chem.Abstr., 1957 , p. 722 |
|
~%
1-amino-4-(meth... CAS#:1220-94-6 |
| Literature: Bayer and Co. Patent: DE156759 ; |
|
~%
1-amino-4-(meth... CAS#:1220-94-6 |
| Literature: Bayer and Co. Patent: DE156759 ; |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Amacel Violet 6B |
| 1-amino-4-N-methylaminoanthraquinone |
| 1-Amino-4-N-methylamino-anthrachinon |
| Disperse Violet 4S |
| Disperse Fast Violet B |
| Dispersol Violet B |
| Oracet Violet BN |
| Supracet Violet 2B |
| Nacelan Violet 4B |
| 1-Amino-4-methylamino-anthrachinon |
| 1-amino-4-methylamino-anthraquinone |
| Solvent violet 12 |
| Disperse violet 4 |
| Oracet Violet B |