cyhalofop structure
|
Common Name | cyhalofop | ||
|---|---|---|---|---|
| CAS Number | 122008-78-0 | Molecular Weight | 301.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H12FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of cyhalofopCyhalofop(Cyhalofop acid) is a recently registered herbicide from the aryloxyphenoxy propionate group in India to control a wide range of grass weed species at various growth stages in rice crop. |
| Name | cyhalofop |
|---|---|
| Synonym | More Synonyms |
| Description | Cyhalofop(Cyhalofop acid) is a recently registered herbicide from the aryloxyphenoxy propionate group in India to control a wide range of grass weed species at various growth stages in rice crop. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H12FNO4 |
|---|---|
| Molecular Weight | 301.27 |
| PSA | 68.55000 |
| LogP | 4.60028 |
| InChIKey | ROBSGBGTWRRYSK-SNVBAGLBSA-N |
| SMILES | CC(Oc1ccc(Oc2ccc(C#N)cc2F)cc1)C(=O)O |
| Storage condition | 2-8℃ |
|
~89%
cyhalofop CAS#:122008-78-0 |
| Literature: Dow AgroSciences LLC Patent: US2009/112015 A1, 2009 ; Location in patent: Page/Page column 2 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| butyl 2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoate |
| (2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoic acid |
| Cyhalofop butyl |
| (R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propionic acid |
| Cyhalofop |
| Cyhalofop acid |
| Cyhalofop butyl ester |
| cyhalofob-butyl |