Cyhalofop-butyl structure
|
Common Name | Cyhalofop-butyl | ||
|---|---|---|---|---|
| CAS Number | 122008-85-9 | Molecular Weight | 357.375 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 449.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H20FNO4 | Melting Point | 49.5ºC | |
| MSDS | Chinese USA | Flash Point | 225.4±28.7 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of Cyhalofop-butylCyhalofop-butyl is a post-emergence herbicide. Cyhalofop-butyl inhibits acetyl-coenzyme A carboxylase (ACCase) biosynthesis[1]. |
| Name | cyhalofop-butyl |
|---|---|
| Synonym | More Synonyms |
| Description | Cyhalofop-butyl is a post-emergence herbicide. Cyhalofop-butyl inhibits acetyl-coenzyme A carboxylase (ACCase) biosynthesis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 449.1±45.0 °C at 760 mmHg |
| Melting Point | 49.5ºC |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.375 |
| Flash Point | 225.4±28.7 °C |
| Exact Mass | 357.137634 |
| PSA | 68.55000 |
| LogP | 4.40 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | TYIYMOAHACZAMQ-CQSZACIVSA-N |
| SMILES | CCCCOC(=O)C(C)Oc1ccc(Oc2ccc(C#N)cc2F)cc1 |
| Storage condition | 0-6°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H400 |
| Precautionary Statements | P273 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,N |
| Risk Phrases | 22-50 |
| Safety Phrases | S22-S24/25 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2926909039 |
| HS Code | 2926909039 |
|---|
| Butyl (R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoate |
| Propanoic acid, 2-[4-(4-cyano-2-fluorophenoxy)phenoxy]-, butyl ester, (2R)- |
| (R)-2-[4-(4-Cyano-2-fluorophenoxy)phenoxy]propionic Acid Butyl Ester |
| MFCD01631151 |
| Cyhalofop butyl ester |
| (R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propionic acid butyl ester |
| UNII:18HGV9OC6G |
| Butyl (2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propionate |
| Clincher |
| Cyhalofop-butyl |
| Butyl (2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoate |
| Cyhalofop Butyl |
| Butyl (R)-2-[4-(4-Cyano-2-fluorophenoxy)phenoxy]propionate |
| (2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propionic acid butyl ester |