Skepinone-L structure
|
Common Name | Skepinone-L | ||
|---|---|---|---|---|
| CAS Number | 1221485-83-1 | Molecular Weight | 425.425 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 629.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H21F2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.2±31.5 °C | |
Use of Skepinone-LSkepinone-L is a selective p38 mitogen-activated protein kinase inhibitor. IC50 value:Target: p38MAPKskepinone-L, the first ATP-competitive p38 MAPK inhibitor with excellent in vivo efficacy and selectivity. Therefore, skepinone-L is a valuable probe for chem. biol. research, and it may foster the development of a unique class of kinase inhibitors. |
| Name | 3-(2,4-difluoroanilino)-9-[(2R)-2,3-dihydroxypropoxy]-5,6-dihydrodibenzo[3,1-[7]annulen-11-one |
|---|---|
| Synonym | More Synonyms |
| Description | Skepinone-L is a selective p38 mitogen-activated protein kinase inhibitor. IC50 value:Target: p38MAPKskepinone-L, the first ATP-competitive p38 MAPK inhibitor with excellent in vivo efficacy and selectivity. Therefore, skepinone-L is a valuable probe for chem. biol. research, and it may foster the development of a unique class of kinase inhibitors. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 629.0±55.0 °C at 760 mmHg |
| Molecular Formula | C24H21F2NO4 |
| Molecular Weight | 425.425 |
| Flash Point | 334.2±31.5 °C |
| Exact Mass | 425.143860 |
| PSA | 78.79000 |
| LogP | 4.95 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | HXMGCTFLLWPVFM-GOSISDBHSA-N |
| SMILES | O=C1c2ccc(Nc3ccc(F)cc3F)cc2CCc2ccc(OCC(O)CO)cc21 |
| Storage condition | -20℃ |
|
~97%
Skepinone-L CAS#:1221485-83-1 |
| Literature: Laufer, Stefan; Albrecht, Wolfgang Patent: US2012/115862 A1, 2012 ; Location in patent: Page/Page column 21 ; |
| Skepinone-L |
| Skepinone-L| |
| 3que |
| 5H-Dibenzo[a,d]cyclohepten-5-one, 2-[(2,4-difluorophenyl)amino]-7-[(2R)-2,3-dihydroxypropoxy]-10,11-dihydro- |
| CS-0941 |
| 2-(2,4-difluorophenylamino)-7-[2R,3-dihydroxypropoxy]-10,11-dihydro-dibenzo[a,d]cyclohepten-5-one |
| X5940 |
| S7214 |
| 2-(2,4-Difluorophenylamino)-7-[2R-,3-dihydroxypropoxy]-10,11-dihydro-dibenzo[a,d]-cyclohepten-5-one |
| 2-[(2,4-Difluorophenyl)amino]-7-[(2R)-2,3-dihydroxypropoxy]-10,11-dihydro-5H-dibenzo[a,d][7]annulen-5-one |
| 2-(2,4-difluoroanilino)-7-[2-(R)-3-dihydroxypropoxy]-10,11-dihydrodibenzo[a,d]cyclohepten-5-one |