2-(4-bromophenyl)-5-chloro-1,3-benzoxazole structure
|
Common Name | 2-(4-bromophenyl)-5-chloro-1,3-benzoxazole | ||
|---|---|---|---|---|
| CAS Number | 122351-86-4 | Molecular Weight | 308.55800 | |
| Density | 1.598g/cm3 | Boiling Point | 370.5ºC at 760 mmHg | |
| Molecular Formula | C13H7BrClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.9ºC | |
| Name | 2-(4-bromophenyl)-5-chloro-1,3-benzoxazole |
|---|
| Density | 1.598g/cm3 |
|---|---|
| Boiling Point | 370.5ºC at 760 mmHg |
| Molecular Formula | C13H7BrClNO |
| Molecular Weight | 308.55800 |
| Flash Point | 177.9ºC |
| Exact Mass | 306.94000 |
| PSA | 26.03000 |
| LogP | 4.91070 |
| Vapour Pressure | 2.35E-05mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | CPHRDAGIDJZPDC-UHFFFAOYSA-N |
| SMILES | Clc1ccc2oc(-c3ccc(Br)cc3)nc2c1 |
| HS Code | 2934999090 |
|---|
|
~77%
2-(4-bromopheny... CAS#:122351-86-4 |
| Literature: Fan, Xuesen; He, Yan; Wang, Yangyang; Zhang, Xinying; Wang, Jianji Chinese Journal of Chemistry, 2011 , vol. 29, # 4 p. 773 - 777 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |