653-47 hydrochloride structure
|
Common Name | 653-47 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1224567-46-7 | Molecular Weight | 407.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20Cl2N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 653-47 hydrochloride653-47 hydrochloride, a potentiator, significantly potentiates the cAMP-response element binding protein (CREB) inhibitory activity of 666-15. 653-47 hydrochloride is also a very weak CREB inhibitor with IC50 of 26.3 μM. |
| Name | 653-47 hydrochloride |
|---|
| Description | 653-47 hydrochloride, a potentiator, significantly potentiates the cAMP-response element binding protein (CREB) inhibitory activity of 666-15. 653-47 hydrochloride is also a very weak CREB inhibitor with IC50 of 26.3 μM. |
|---|
| Molecular Formula | C20H20Cl2N2O3 |
|---|---|
| Molecular Weight | 407.29 |
| InChIKey | HESNWSHDEFHION-UHFFFAOYSA-N |
| SMILES | Cl.NCCCOc1cc2ccccc2cc1C(=O)Nc1ccc(Cl)cc1O |