SA 47 structure
|
Common Name | SA 47 | ||
|---|---|---|---|---|
| CAS Number | 792236-07-8 | Molecular Weight | 334.41300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H26N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SA 47SA 47 is a selective and potent inhibitor of fatty acid amide hydrolase (FAAH) and carbamate[1]. |
| Name | 2-(Methylamino)-2-oxoethyl {2-[1-(6-methyl-2-pyridinyl)-4-piperid inyl]ethyl}carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | SA 47 is a selective and potent inhibitor of fatty acid amide hydrolase (FAAH) and carbamate[1]. |
|---|---|
| Related Catalog | |
| Target |
FAAH, Carbamate[1]. |
| References |
| Molecular Formula | C17H26N4O3 |
|---|---|
| Molecular Weight | 334.41300 |
| Exact Mass | 334.20000 |
| PSA | 90.54000 |
| LogP | 2.57840 |
| InChIKey | HSYCMGWPPRTNKH-UHFFFAOYSA-N |
| SMILES | CNC(=O)COC(=O)NCCC1CCN(c2cccc(C)n2)CC1 |
| ML 298 hydrochloride |