dTAG-47 structure
|
Common Name | dTAG-47 | ||
|---|---|---|---|---|
| CAS Number | 2265886-81-3 | Molecular Weight | 1076.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C59H73N5O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of dTAG-47dTAG-47, heterobifunctional dTAG molecule, targets mutant FKBP12 (FKBP12F36V). FKBP12F36V serves as a degradation tag (dTAG) and is fused to a protein of interest. dTAG-47 can be used for the research of basal-like breast cancers (BBC)[1]. |
| Name | dTAG-47 |
|---|
| Description | dTAG-47, heterobifunctional dTAG molecule, targets mutant FKBP12 (FKBP12F36V). FKBP12F36V serves as a degradation tag (dTAG) and is fused to a protein of interest. dTAG-47 can be used for the research of basal-like breast cancers (BBC)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C59H73N5O14 |
|---|---|
| Molecular Weight | 1076.24 |
| InChIKey | OQXAQHQPOQLCAE-ODPQSFPTSA-N |
| SMILES | CCC(C(=O)N1CCCCC1C(=O)OC(CCc1ccc(OC)c(OC)c1)c1ccccc1OCC(=O)NCCCCCCCCNc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O)c1cc(OC)c(OC)c(OC)c1 |