Methyl 4-bromo-1H-indole-7-carboxylate structure
|
Common Name | Methyl 4-bromo-1H-indole-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1224724-39-3 | Molecular Weight | 254.080 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 402.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.1±23.2 °C | |
| Name | Methyl 4-bromo-1H-indole-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.3±25.0 °C at 760 mmHg |
| Molecular Formula | C10H8BrNO2 |
| Molecular Weight | 254.080 |
| Flash Point | 197.1±23.2 °C |
| Exact Mass | 252.973831 |
| PSA | 42.09000 |
| LogP | 2.87 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | JTBLJEGYYYHKGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(Br)c2cc[nH]c12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~31%
Methyl 4-bromo-... CAS#:1224724-39-3 |
| Literature: InterMune, Inc. Patent: US2011/152246 A1, 2011 ; Location in patent: Page/Page column 187 ; |
|
~%
Methyl 4-bromo-... CAS#:1224724-39-3 |
| Literature: InterMune, Inc. Patent: US2011/152246 A1, 2011 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methyl 4-bromo-1H-indole-7-carboxylate |
| 1H-Indole-7-carboxylic acid, 4-bromo-, methyl ester |