4-Bromo-2-nitrobenzoic acid structure
|
Common Name | 4-Bromo-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 99277-71-1 | Molecular Weight | 246.01 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 368.6±32.0 °C at 760 mmHg | |
| Molecular Formula | C7H4BrNO4 | Melting Point | 165-169 °C | |
| MSDS | Chinese USA | Flash Point | 176.7±25.1 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of 4-Bromo-2-nitrobenzoic acid4-Bromo-2-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 4-Bromo-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 4-Bromo-2-nitrobenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog | |
| In Vitro | 4-Bromo-2-nitrobenzoic acid (CAS# 99277-71-1) 是合成潜在抗癌剂 Lonafarnib (L469445) 的中间体。 |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 368.6±32.0 °C at 760 mmHg |
| Melting Point | 165-169 °C |
| Molecular Formula | C7H4BrNO4 |
| Molecular Weight | 246.01 |
| Flash Point | 176.7±25.1 °C |
| Exact Mass | 244.932358 |
| PSA | 83.12000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | ZIRHHEZLJGORGU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Br)cc1[N+](=O)[O-] |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H317-H319-H335-H400 |
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful;N:Dangerousfortheenvironment; |
| Risk Phrases | R22;R36/37/38;R43;R50 |
| Safety Phrases | S26-S36/37-S61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| Packaging Group | III |
| Hazard Class | 9.0 |
| HS Code | 2916399090 |
|
~0%
4-Bromo-2-nitro... CAS#:99277-71-1 |
| Literature: Chiron Corporation Patent: US2005/261307 A1, 2005 ; |
|
~%
4-Bromo-2-nitro... CAS#:99277-71-1 |
| Literature: Journal of Organic Chemistry, , vol. 62, # 5 p. 1240 - 1256 |
|
~%
4-Bromo-2-nitro... CAS#:99277-71-1 |
| Literature: US2004/116422 A1, ; Page/Page column 30-31 ; |
|
~%
4-Bromo-2-nitro... CAS#:99277-71-1 |
| Literature: Journal of the American Chemical Society, , vol. 82, p. 5918 - 5923 |
|
~%
4-Bromo-2-nitro... CAS#:99277-71-1 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 7, p. 436,443 |
|
~%
4-Bromo-2-nitro... CAS#:99277-71-1 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 43, p. 204 |
|
~%
4-Bromo-2-nitro... CAS#:99277-71-1 |
| Literature: Journal of the Chemical Society, , p. 1803 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Tetrahedron Lett. 45 , 817, (2004)
|
| MFCD01013599 |
| 4-Bromo-2-nitrobenzoic acid |
| 2-nitro-4-bromobenzoic acid |
| F9995-0102 |
| Benzoic acid, 4-bromo-2-nitro- |
| 4-Brom-2-nitro-benzoesaeure |
| WNR CE FVQ |
| 4-Bromo-2-nitrobenzoicacid |