2-cyano-3-(4-hydroxyphenyl)prop-2-enamide structure
|
Common Name | 2-cyano-3-(4-hydroxyphenyl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 122520-81-4 | Molecular Weight | 188.18300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyano-3-(4-hydroxyphenyl)prop-2-enamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8N2O2 |
|---|---|
| Molecular Weight | 188.18300 |
| Exact Mass | 188.05900 |
| PSA | 88.10000 |
| LogP | 1.93418 |
| InChIKey | ILLYSIXRHPOKIQ-UHFFFAOYSA-N |
| SMILES | N#CC(=Cc1ccc(O)cc1)C(N)=O |
|
~97%
2-cyano-3-(4-hy... CAS#:122520-81-4 |
| Literature: Kaupp, Gerd; Naimi-Jamal, M. Reza; Schmeyers, Jens Tetrahedron, 2003 , vol. 59, # 21 p. 3753 - 3760 |
|
~75%
2-cyano-3-(4-hy... CAS#:122520-81-4 |
| Literature: Rauf, Abdul; Awan, Faisal Saleem; Mumtaz, Saira; Sharif, Ahsan; Ahmed, Ejaz; Arshad, Muhammad; Kausar, Farzana; Yasmin, Ghazala; Qureshi, Ashfaq Mahmood Journal of the Chemical Society of Pakistan, 2012 , vol. 34, # 3 p. 728 - 731 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| p-hydroxybenzylidenecyanoacetamide |
| (E)-2-cyano-3-(4-hydroxyphenyl)acrylamide |
| 2-cyano-3-(4-hydroxyphenyl)acrylamide |
| 2-(4-hydroxybenzylidene)-2-cyanoacetamide |
| 2-Propenamide,2-cyano-3-(4-hydroxyphenyl)-,(2E) |