alpha-cyano-4-hydroxycinnamic acid dieth structure
|
Common Name | alpha-cyano-4-hydroxycinnamic acid dieth | ||
|---|---|---|---|---|
| CAS Number | 355011-52-8 | Molecular Weight | 262.30400 | |
| Density | N/A | Boiling Point | 438ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O3 | Melting Point | -170ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | 218.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (Z)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid,N-ethylethanamine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 438ºC at 760 mmHg |
|---|---|
| Melting Point | -170ºC (dec.) |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.30400 |
| Flash Point | 218.7ºC |
| Exact Mass | 262.13200 |
| PSA | 93.35000 |
| LogP | 2.39048 |
| InChIKey | SHCCRJCGLMIMLV-HAAWTFQLSA-N |
| SMILES | CCNCC.N#CC(=Cc1ccc(O)cc1)C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26;S36/S37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Ionic liquids as matrixes for matrix-assisted laser desorption/ionization mass spectrometry.
Anal. Chem. 73 , 3679 , (2001) Room-temperature ionic liquids are useful as solvents for organic synthesis, electrochemical studies, and separations. We wished to examine whether their high solubalizing power, negligible vapor pres... |
| MFCD06201009 |
| |A-Cyano-4-hydroxycinnamic acid diethylammonium salt |