7-chloro-2-(4-methoxyphenyl)chromen-4-one structure
|
Common Name | 7-chloro-2-(4-methoxyphenyl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 1226-05-7 | Molecular Weight | 286.71000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-chloro-2-(4-methoxyphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H11ClO3 |
|---|---|
| Molecular Weight | 286.71000 |
| Exact Mass | 286.04000 |
| PSA | 39.44000 |
| LogP | 4.12200 |
| InChIKey | ZJAHDJINJDHWCO-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(=O)c3ccc(Cl)cc3o2)cc1 |
|
~%
7-chloro-2-(4-m... CAS#:1226-05-7 |
| Literature: Chen; Chang Journal of the Chemical Society, 1958 , p. 146,149 |
| 7-Chlor-2-(4-methoxy-phenyl)-chromen-4-on |
| 7-chloro-2-(4-methoxy-phenyl)-chromen-4-one |
| 7-Chlor-4'-methoxy-flavon |
| 7-CHLORO-2-(4-METHOXYPHENYL)-4H-CHROMEN-4-ONE |