Cobitolimod structure
|
Common Name | Cobitolimod | ||
|---|---|---|---|---|
| CAS Number | 1226822-98-5 | Molecular Weight | 5925.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C185H233N73O106P18S6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CobitolimodCobitolimod is a DNA oligonucleotide agonist of TLR-9 with anti-inflammatory activity. Cobitolimod suppresses Th17 cells and induces anti-inflammatory FoxP3 and IL-10 expression, inhibiting the IL-17 signaling pathway[1]. |
| Name | Cobitolimod |
|---|
| Description | Cobitolimod is a DNA oligonucleotide agonist of TLR-9 with anti-inflammatory activity. Cobitolimod suppresses Th17 cells and induces anti-inflammatory FoxP3 and IL-10 expression, inhibiting the IL-17 signaling pathway[1]. |
|---|---|
| Related Catalog | |
| Target |
TLR-9[1] |
| References |
| Molecular Formula | C185H233N73O106P18S6 |
|---|---|
| Molecular Weight | 5925.20 |
| InChIKey | IXYNFLOLUBKHQU-FZCWJHTDSA-N |
| SMILES | Cc1cn(C2CC(OP(=O)(O)OCC3OC(n4ccc(N)nc4=O)CC3OP(=O)(O)OCC3OC(n4cnc5c(=O)[nH]c(N)nc54)CC3OP(=O)(O)OCC3OC(n4cc(C)c(=O)[nH]c4=O)CC3OP(=O)(O)OCC3OC(n4ccc(N)nc4=O)CC3OP(=O)(O)OCC3OC(n4ccc(N)nc4=O)CC3OP(=O)(O)OCC3OC(n4cnc5c(N)ncnc54)CC3OP(=O)(O)OCC3OC(n4cc(C)c(=O)[nH]c4=O)CC3OP(O)(=S)OCC3OC(n4cnc5c(=O)[nH]c(N)nc54)CC3OP(O)(=S)OCC3OC(n4cnc5c(=O)[nH]c(N)nc54)CC3OP(O)(=S)OCC3OC(n4ccc(N)nc4=O)CC3O)C(COP(=O)(O)OC3CC(n4cc(C)c(=O)[nH]c4=O)OC3COP(=O)(O)OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3COP(=O)(O)OC3CC(n4cnc5c(N)ncnc54)OC3COP(=O)(O)OC3CC(n4ccc(N)nc4=O)OC3COP(=O)(O)OC3CC(n4cnc5c(N)ncnc54)OC3COP(O)(=S)OC3CC(n4cnc5c(N)ncnc54)OC3COP(O)(=S)OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3COP(O)(=S)OC3CC(n4cnc5c(=O)[nH]c(N)nc54)OC3CO)O2)c(=O)[nH]c1=O |