(2R)-6-(Hydroxymethyl)-2,5,7-trimethyl-1-indanone structure
|
Common Name | (2R)-6-(Hydroxymethyl)-2,5,7-trimethyl-1-indanone | ||
|---|---|---|---|---|
| CAS Number | 1226892-20-1 | Molecular Weight | 204.26 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 387.7±41.0 °C at 760 mmHg | |
| Molecular Formula | C13H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.6±20.2 °C | |
Use of (2R)-6-(Hydroxymethyl)-2,5,7-trimethyl-1-indanone(2R)-Norpterosin B is a sesquiterpenoid isolated from Pteris semipinnata[1]. |
| Name | (R)-6-(hydroxymethyl)-2,5,7-trimethyl-2,3-dihydro-1H-inden-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | (2R)-Norpterosin B is a sesquiterpenoid isolated from Pteris semipinnata[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.7±41.0 °C at 760 mmHg |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.26 |
| Flash Point | 165.6±20.2 °C |
| Exact Mass | 204.115036 |
| PSA | 37.30000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | FUOYIVLWRSGBHK-MRVPVSSYSA-N |
| SMILES | Cc1cc2c(c(C)c1CO)C(=O)C(C)C2 |
| Hazard Codes | Xi |
|---|
| (2R)-6-(Hydroxymethyl)-2,5,7-trimethyl-1-indanone |
| 1H-Inden-1-one, 2,3-dihydro-6-(hydroxymethyl)-2,5,7-trimethyl-, (2R)- |