FLLL32 structure
|
Common Name | FLLL32 | ||
|---|---|---|---|---|
| CAS Number | 1226895-15-3 | Molecular Weight | 464.55 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FLLL32FLLL32 is a STAT3 inhibitor derived from the natural product curcumin. FLLL32 retains the cellular response to cytokines with anti-tumor activity[1]. |
| Name | flll32 |
|---|---|
| Synonym | More Synonyms |
| Description | FLLL32 is a STAT3 inhibitor derived from the natural product curcumin. FLLL32 retains the cellular response to cytokines with anti-tumor activity[1]. |
|---|---|
| Related Catalog | |
| Target |
STAT3[1] |
| In Vitro | FLLL32 specifically reduces STAT3 phosphorylation at Tyr705 (pSTAT3) and induces apoptosis at micromolar amounts in human melanoma cell lines and primary melanoma cultures[1]. |
| References |
| Molecular Formula | C28H32O6 |
|---|---|
| Molecular Weight | 464.55 |
| Exact Mass | 464.22000 |
| PSA | 71.06000 |
| LogP | 5.53630 |
| InChIKey | NQDROBVIYYEMDQ-WFYKWJGLSA-N |
| SMILES | COc1ccc(C=CC(=O)C2(C(=O)C=Cc3ccc(OC)c(OC)c3)CCCCC2)cc1OC |
| Storage condition | -20℃ |
| MFCD22200575 |