MK-7622 structure
|
Common Name | MK-7622 | ||
|---|---|---|---|---|
| CAS Number | 1227923-29-6 | Molecular Weight | 399.485 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 643.0±65.0 °C at 760 mmHg | |
| Molecular Formula | C25H25N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 342.7±34.3 °C | |
Use of MK-7622MK-7622 is a muscarinic M1 receptor positive allosteric modulator.Target: M1 receptorMK-7622 is useful in the treatment of diseases in which the M1 receptor is involved, such as Alzheimer's disease, schizophrenia, pain or sleep disorders. |
| Name | 3-[(1S,2S)-2-Hydroxycyclohexyl]-6-[(6-methyl-3-pyridinyl)methyl]b enzo[h]quinazolin-4(3H)-one |
|---|---|
| Synonym | More Synonyms |
| Description | MK-7622 is a muscarinic M1 receptor positive allosteric modulator.Target: M1 receptorMK-7622 is useful in the treatment of diseases in which the M1 receptor is involved, such as Alzheimer's disease, schizophrenia, pain or sleep disorders. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 643.0±65.0 °C at 760 mmHg |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.485 |
| Flash Point | 342.7±34.3 °C |
| Exact Mass | 399.194672 |
| PSA | 68.01000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.687 |
| InChIKey | JUVQLZBJFOGEEO-GOTSBHOMSA-N |
| SMILES | Cc1ccc(Cc2cc3c(=O)n(C4CCCCC4O)cnc3c3ccccc23)cn1 |
|
~%
MK-7622 CAS#:1227923-29-6 |
| Literature: WO2012/47702 A1, ; Page/Page column 39 ; WO 2012/047702 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(6-methylpyridin-3-yl)methyl]benzo[h]quinazolin-4(3H)-one |
| (S)-3-(1-AMINOETHYL)BENZENAMINE |
| 3-[(1S)-1-azanylethyl]aniline |
| Benzo[h]quinazolin-4(3H)-one, 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(6-methyl-3-pyridinyl)methyl]- |
| (S)-1-(3-Aminophenyl)-1-aminoethane |
| 3-[(1S,2S)-2-Hydroxycyclohexyl]-6-[(6-methyl-3-pyridinyl)methyl]benzo[h]quinazolin-4(3H)-one |
| MK-7622 |