{3-[(tert-Butoxycarbonyl)amino]phenyl}acetic acid structure
|
Common Name | {3-[(tert-Butoxycarbonyl)amino]phenyl}acetic acid | ||
|---|---|---|---|---|
| CAS Number | 123036-51-1 | Molecular Weight | 251.278 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 355.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C13H17NO4 | Melting Point | 100-102ºC | |
| MSDS | N/A | Flash Point | 168.9±23.2 °C | |
| Name | N-Boc-3-aminophenylacetic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.6±25.0 °C at 760 mmHg |
| Melting Point | 100-102ºC |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.278 |
| Flash Point | 168.9±23.2 °C |
| Exact Mass | 251.115753 |
| PSA | 75.63000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | RGLDALVJLSFYMV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cccc(CC(=O)O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~98%
{3-[(tert-Butox... CAS#:123036-51-1 |
| Literature: Tetrahedron, , vol. 58, # 43 p. 8695 - 8702 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| {3-[(tert-Butoxycarbonyl)amino]phenyl}acetic acid |
| [3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)phenyl]acetic acid |
| Benzeneacetic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]- |
| N-Boc-3-Aminophenylacetic acid |
| 2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetic acid |