Rivastigmine structure
|
Common Name | Rivastigmine | ||
|---|---|---|---|---|
| CAS Number | 123441-03-2 | Molecular Weight | 250.34 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 316.2±34.0 °C at 760 mmHg | |
| Molecular Formula | C14H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.0±25.7 °C | |
Use of RivastigmineRivastigmine, an cholinesterase inhibitor(IC50= 5.5 uM), inhibits both butyrylcholinesterase and acetylcholinesteraseIC50 value: 5.5 uMTarget: AChERivastigmine is a parasympathomimetic or cholinergic agent for the treatment of mild to moderate dementia of the Alzheimer's type and dementia due to Parkinson's disease. The drug can be administered orally or via a transdermal patch; the latter form reduces the prevalence of side effects, which typically include nausea and vomiting. The drug is eliminated through the urine, and appears to have relatively few drug-drug interactions. Rivastigmine, a cholinesterase inhibitor, inhibits both butyrylcholinesterase and acetylcholinesterase. It is thought to work by inhibiting these cholinesterase enzymes, which would otherwise break down the brain chemical acetylcholine. |
| Name | rivastigmine |
|---|---|
| Synonym | More Synonyms |
| Description | Rivastigmine, an cholinesterase inhibitor(IC50= 5.5 uM), inhibits both butyrylcholinesterase and acetylcholinesteraseIC50 value: 5.5 uMTarget: AChERivastigmine is a parasympathomimetic or cholinergic agent for the treatment of mild to moderate dementia of the Alzheimer's type and dementia due to Parkinson's disease. The drug can be administered orally or via a transdermal patch; the latter form reduces the prevalence of side effects, which typically include nausea and vomiting. The drug is eliminated through the urine, and appears to have relatively few drug-drug interactions. Rivastigmine, a cholinesterase inhibitor, inhibits both butyrylcholinesterase and acetylcholinesterase. It is thought to work by inhibiting these cholinesterase enzymes, which would otherwise break down the brain chemical acetylcholine. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 316.2±34.0 °C at 760 mmHg |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 |
| Flash Point | 145.0±25.7 °C |
| PSA | 147.84000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | XSVMFMHYUFZWBK-NSHDSACASA-N |
| SMILES | CCN(C)C(=O)Oc1cccc(C(C)N(C)C)c1 |
| Hazard Codes | Xi |
|---|
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| Carbamic acid, N-ethyl-N-methyl-, 3-[(1S)-1-(dimethylamino)ethyl]phenyl ester |
| [3-[(1S)-1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate |
| MFCD03700731 |
| (S)-N-ethyl-3-[(1-dimethylamino)ethyl]-N-methylphenylcarbamate |
| Rivastigmine |
| N-Ethyl-N-methylcarbamic acid 3-[(1S)-1-(dimethylamino)ethyl]phenyl-ester |
| (S)-3-(1-(dimethylamino)ethyl)phenyl ethyl(methyl)carbamate |
| Ethylmethylcarbamic acid 3-[(1S)-1-(dimethylamino)ethyl]phenyl ester |
| 3-((1S)-1-(Dimethylamino)ethyl)phenyl ethylmethylcarbamate |
| carbamic acid, ethyl(methyl)-, 3-[(1S)-1-(dimethylamino)ethyl]phenyl ester |
| 3-[(1S)-1-(Dimethylamino)ethyl]phenyl ethyl(methyl)carbamate |