Lalistat 2 structure
|
Common Name | Lalistat 2 | ||
|---|---|---|---|---|
| CAS Number | 1234569-09-5 | Molecular Weight | 296.388 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 438.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C13H20N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.0±28.7 °C | |
Use of Lalistat 2Lalistat 2 is a specific inhibitor of lysosomal acid lipase (LAL) with no effect on other forms of lipase[1]. |
| Name | Lalistat 2 |
|---|---|
| Synonym | More Synonyms |
| Description | Lalistat 2 is a specific inhibitor of lysosomal acid lipase (LAL) with no effect on other forms of lipase[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 438.5±45.0 °C at 760 mmHg |
| Molecular Formula | C13H20N4O2S |
| Molecular Weight | 296.388 |
| Flash Point | 219.0±28.7 °C |
| Exact Mass | 296.130707 |
| LogP | 3.29 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | PNYYVHOTXOEBEV-UHFFFAOYSA-N |
| SMILES | O=C(Oc1nsnc1N1CCCCC1)N1CCCCC1 |
| MFCD31544494 |
| 4-(1-Piperidinyl)-1,2,5-thiadiazol-3-yl 1-piperidinecarboxylate |
| 1-Piperidinecarboxylic acid 4-(1-piperidinyl)-1,2,5-thiadiazol-3-yl ester |
| 1-Piperidinecarboxylic acid, 4-(1-piperidinyl)-1,2,5-thiadiazol-3-yl ester |
| Lalistat-2 |
| Lalistat 2 |