1H-Isoindole-1,3(2H)-dione,4,5-dimethoxy- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,4,5-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 4667-74-7 | Molecular Weight | 207.18300 | |
| Density | 1.331g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-dimethoxyisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.331g/cm3 |
|---|---|
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.18300 |
| Exact Mass | 207.05300 |
| PSA | 64.63000 |
| LogP | 0.91620 |
| Index of Refraction | 1.566 |
| InChIKey | CQXJYTYXSDPYCB-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1OC)C(=O)NC2=O |
| HS Code | 2925190090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 4 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Hemipinimid |
| hemipinimide |
| N-hydroxy-5,6-dimethylphthalimide |
| 4,5-Dimethoxy-isoindolin-1,3-dion |
| 3,4-dimethoxyphthalimide |
| 4,5-dimethoxy-isoindoline-1,3-dione |