4-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]butanoic acid structure
|
Common Name | 4-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 123941-02-6 | Molecular Weight | 264.32000 | |
| Density | 1.177g/cm3 | Boiling Point | 477.2ºC at 760mmHg | |
| Molecular Formula | C14H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.4ºC | |
| Name | 4-[[2-(2,6-dimethylanilino)-2-oxoethyl]amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.177g/cm3 |
|---|---|
| Boiling Point | 477.2ºC at 760mmHg |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32000 |
| Flash Point | 242.4ºC |
| Exact Mass | 264.14700 |
| PSA | 81.92000 |
| LogP | 2.73670 |
| Vapour Pressure | 6.48E-10mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | NAAZEZUKLGBHJF-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1NC(=O)CNCCCC(=O)O |
|
~74%
4-[[2-(2,6-dime... CAS#:123941-02-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 13 p. 3712 - 3715 |
|
~%
4-[[2-(2,6-dime... CAS#:123941-02-6 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 13 p. 3712 - 3715 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Butanoic acid,4-((2-((2,6-dimethylphenyl)amino)-2-oxoethyl)amino) |
| Nefiracetam D-2 |
| 4-((2-((2,6-Dimethylphenyl)amino)-2-oxoethyl)amino)butanoic acid |