Almokalant structure
|
Common Name | Almokalant | ||
|---|---|---|---|---|
| CAS Number | 123955-10-2 | Molecular Weight | 352.49200 | |
| Density | 1.17g/cm3 | Boiling Point | 574.8ºC at 760mmHg | |
| Molecular Formula | C18H28N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301.4ºC | |
Use of AlmokalantAlmokalant is a class III antiarrhythmic drug, acts as a potassium channel blocker, and inhibits a specific component (Ikr) of the time-dependent delayed rectifier K+ current. |
| Name | 4-[3-[ethyl(3-propylsulfinylpropyl)amino]-2-hydroxypropoxy]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | Almokalant is a class III antiarrhythmic drug, acts as a potassium channel blocker, and inhibits a specific component (Ikr) of the time-dependent delayed rectifier K+ current. |
|---|---|
| Related Catalog | |
| Target |
Potassium channel[1] |
| In Vitro | Almokalant is a class III antiarrhythmic drug, acts as a potassium channel blocker, and inhibits a specific component (Ikr) of the time-dependent delayed rectifier K+ current[1]. |
| In Vivo | Almokalant (125 μmol/kg, p.o.) induces cardiovascular defects, orofacial clefts, and tail defects in pregnant rats, after administration on Day 11. Almokalant also causes in pregnant rats[1]. |
| References |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 574.8ºC at 760mmHg |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.49200 |
| Flash Point | 301.4ºC |
| Exact Mass | 352.18200 |
| PSA | 92.77000 |
| LogP | 3.03438 |
| Vapour Pressure | 4.73E-14mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | ZMHOBBKJBYLXFR-UHFFFAOYSA-N |
| SMILES | CCCS(=O)CCCN(CC)CC(O)COc1ccc(C#N)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
~%
Almokalant CAS#:123955-10-2 |
| Literature: Aktiebolaget Hassle Patent: US5068272 A1, 1991 ; |
|
~%
Almokalant CAS#:123955-10-2 |
| Literature: Aktiebolaget Hassle Patent: US5055490 A1, 1991 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(3-(Ethyl(3-(propylsulfinyl)propyl)amino)-2-hydroxypropoxy)benzonitrile |
| Benzonitrile,4-(3-(ethyl(3-(propylsulfinyl)propyl)amino)-2-hydroxypropoxy) |
| Almokalantum [INN-Latin] |
| Almoklant |
| Almokalant [INN] |
| (+-)-p-(3-(Ethyl(3-(propylsulfinyl)propyl)amino)-2-hydroxypropoxy)benzonitrile |
| 4-[3-[ethyl[3-((R*)-propylsulfinyl)propyl]amino]-2(R)-hydroxypropoxy]-benzonitrile |
| Almokalantum |
| Almokalant |