Tizoxanide-d4 structure
|
Common Name | Tizoxanide-d4 | ||
|---|---|---|---|---|
| CAS Number | 1246817-56-0 | Molecular Weight | 269.270 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H3D4N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tizoxanide-d4Tizoxanide D4 (TIZ D4) is the deuterium labeled Tizoxanide. Tizoxanide is the active metabolite of Nitazoxanide, which is a thiazolide anti-infective compound against anaerobic bacteria, protozoa, and a range of viruses. Tizoxanide has anti-HIV-1 activities[1][2]. |
| Name | Tizoxanide-d4 |
|---|---|
| Synonym | More Synonyms |
| Description | Tizoxanide D4 (TIZ D4) is the deuterium labeled Tizoxanide. Tizoxanide is the active metabolite of Nitazoxanide, which is a thiazolide anti-infective compound against anaerobic bacteria, protozoa, and a range of viruses. Tizoxanide has anti-HIV-1 activities[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C10H3D4N3O4S |
| Molecular Weight | 269.270 |
| Exact Mass | 269.040833 |
| LogP | 2.91 |
| Index of Refraction | 1.750 |
| InChIKey | FDTZUTSGGSRHQF-RHQRLBAQSA-N |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1ccccc1O |
| 2-Hydroxy-N-(5-nitro-1,3-thiazol-2-yl)(2H4)benzamide |
| Benzamide-2,3,4,5-d4, 6-hydroxy-N-(5-nitro-2-thiazolyl)- |
| Tizoxanide-d4 |