Dovitinib-d8 structure
|
Common Name | Dovitinib-d8 | ||
|---|---|---|---|---|
| CAS Number | 1246819-84-0 | Molecular Weight | 400.479 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H13D8FN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Dovitinib-d8Dovitinib-D8 (CHIR-258-D8) is the deuterium labeled Dovitinib. Dovitinib (CHIR-258) is a multi-targeted tyrosine kinase inhibitor with IC50s of 1, 2, 8/9, 10/13/8, 27/210 nM for FLT3, c-Kit, FGFR1/FGFR3, VEGFR1/VEGFR2/VEGFR3 and PDGFRα/PDGFRβ, respectively[1][2]. |
| Name | Dovitinib-d8 |
|---|---|
| Synonym | More Synonyms |
| Description | Dovitinib-D8 (CHIR-258-D8) is the deuterium labeled Dovitinib. Dovitinib (CHIR-258) is a multi-targeted tyrosine kinase inhibitor with IC50s of 1, 2, 8/9, 10/13/8, 27/210 nM for FLT3, c-Kit, FGFR1/FGFR3, VEGFR1/VEGFR2/VEGFR3 and PDGFRα/PDGFRβ, respectively[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C21H13D8FN6O |
| Molecular Weight | 400.479 |
| Exact Mass | 400.226288 |
| LogP | 1.59 |
| Index of Refraction | 1.691 |
| InChIKey | VRLGJSYPIOVRLQ-UFBJYANTSA-N |
| SMILES | CN1CCN(c2ccc3nc(C4=C(N)C5C(F)=CC=CC5=NC4=O)[nH]c3c2)CC1 |
| 2(1H)-Quinolinone, 4-amino-5-fluoro-3-[6-(4-methyl-1-piperazinyl-2,2,3,3,5,5,6,6-d8)-1H-benzimidazol-2-yl]- |
| Dovitinib-d8 |
| 4-Amino-5-fluoro-3-{6-[4-methyl(2H8)-1-piperazinyl]-1H-benzimidazol-2-yl}-2(1H)-quinolinone |