GLP-1 receptor agonist 5 structure
|
Common Name | GLP-1 receptor agonist 5 | ||
|---|---|---|---|---|
| CAS Number | 1246826-07-2 | Molecular Weight | 856.83 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C50H47Cl2N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GLP-1 receptor agonist 5GLP-1 receptor agonist 5 is a GLP-1 receptor agonist extracted from patent WO2010114824A1, Example 179, with an EC50 of 5 nM[1]. |
| Name | GLP-1 receptor agonist 5 |
|---|
| Description | GLP-1 receptor agonist 5 is a GLP-1 receptor agonist extracted from patent WO2010114824A1, Example 179, with an EC50 of 5 nM[1]. |
|---|---|
| Target |
EC50: 5 nM (GLP-1 receptor)[1] |
| References |
| Molecular Formula | C50H47Cl2N3O6 |
|---|---|
| Molecular Weight | 856.83 |
| InChIKey | DEDPYBWOUXWMOX-ZTAAISNPSA-N |
| SMILES | CCC(c1ccccc1)N1Cc2cc3c(cc2CC1C(=O)NC(Cc1ccc(-c2ccnc(C)c2C)cc1)C(=O)O)OCC(c1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)O3 |