4,4,5,5,6,6,7,7,7-nonafluoroheptane-1,2-diol structure
|
Common Name | 4,4,5,5,6,6,7,7,7-nonafluoroheptane-1,2-diol | ||
|---|---|---|---|---|
| CAS Number | 125070-38-4 | Molecular Weight | 294.11500 | |
| Density | 1.558g/cm3 | Boiling Point | 104ºC | |
| Molecular Formula | C7H7F9O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 61.7ºC | |
| Name | 4,4,5,5,6,6,7,7,7-nonafluoroheptane-1,2-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.558g/cm3 |
|---|---|
| Boiling Point | 104ºC |
| Molecular Formula | C7H7F9O2 |
| Molecular Weight | 294.11500 |
| Flash Point | 61.7ºC |
| Exact Mass | 294.03000 |
| PSA | 40.46000 |
| LogP | 2.19790 |
| Vapour Pressure | 0.298mmHg at 25°C |
| Index of Refraction | 1.333 |
| InChIKey | FAQXMAJQQVDRQM-UHFFFAOYSA-N |
| SMILES | OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi |
|---|
|
~97%
4,4,5,5,6,6,7,7... CAS#:125070-38-4 |
| Literature: Cirkva, Vladimir; Ameduri, Bruno; Boutevin, Bernard; Paleta, Oldrich Journal of Fluorine Chemistry, 1997 , vol. 84, # 1 p. 53 - 61 |
|
~%
4,4,5,5,6,6,7,7... CAS#:125070-38-4 |
| Literature: Cirkva, Vladimir; Ameduri, Bruno; Boutevin, Bernard; Paleta, Oldrich Journal of Fluorine Chemistry, 1997 , vol. 84, # 1 p. 53 - 61 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| pc4785 |