1-bromooctafluoro-1-(trifluoromethyl)cyclopentane structure
|
Common Name | 1-bromooctafluoro-1-(trifluoromethyl)cyclopentane | ||
|---|---|---|---|---|
| CAS Number | 125112-68-7 | Molecular Weight | 360.95100 | |
| Density | 1.97g/cm3 | Boiling Point | 91.7ºC at 760mmHg | |
| Molecular Formula | C6BrF11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 9.3ºC | |
| Name | 1-bromo-2,2,3,3,4,4,5,5-octafluoro-1-(trifluoromethyl)cyclopentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.97g/cm3 |
|---|---|
| Boiling Point | 91.7ºC at 760mmHg |
| Molecular Formula | C6BrF11 |
| Molecular Weight | 360.95100 |
| Flash Point | 9.3ºC |
| Exact Mass | 359.90100 |
| LogP | 4.23720 |
| Vapour Pressure | 60.4mmHg at 25°C |
| Index of Refraction | 1.326 |
| InChIKey | WODMJKXUZQZFRA-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C1(Br)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| MFCD00077573 |
| 1-Bromo-1-trifluoromethyl-2,2,3,3,4,4,5,5-octafluorocyclopentane |
| PC1516 |
| Perfluoro-1-methylcyclopentyl bromide |