METCONAZOLE structure
|
Common Name | METCONAZOLE | ||
|---|---|---|---|---|
| CAS Number | 125116-23-6 | Molecular Weight | 319.82900 | |
| Density | 1.24g/cm3 | Boiling Point | 469.1ºC at 760mmHg | |
| Molecular Formula | C17H22ClN3O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 237.5ºC | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
| Name | metconazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 469.1ºC at 760mmHg |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.82900 |
| Flash Point | 237.5ºC |
| Exact Mass | 319.14500 |
| PSA | 50.94000 |
| LogP | 3.34150 |
| Vapour Pressure | 1.33E-09mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | XWPZUHJBOLQNMN-UHFFFAOYSA-N |
| SMILES | CC1(C)CCC(Cc2ccc(Cl)cc2)C1(O)Cn1cncn1 |
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H361d-H411 |
| Precautionary Statements | P273-P281 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,N |
| Risk Phrases | R22 |
| Safety Phrases | S60 |
| RIDADR | UN3077 9/PG 3 |
|
~%
Detail
|
| Literature: US5466816 A1, ; |
|
~69%
METCONAZOLE CAS#:125116-23-6 |
| Literature: KUREHA KAGAKU KOGYO KABUSHIKI KAISHA Patent: EP329397 A1, 1989 ; |
|
Detail
|
| Literature: KUREHA KAGAKU KOGYO KABUSHIKI KAISHA Patent: EP329397 A1, 1989 ; |
|
~%
METCONAZOLE CAS#:125116-23-6 |
| Literature: US5466816 A1, ; |
|
Detail
|
| Literature: US5466816 A1, ; |
|
Detail
|
| Literature: US5466816 A1, ; |
|
~55%
Detail
|
| Literature: KUREHA KAGAKU KOGYO KABUSHIKI KAISHA Patent: EP329397 A1, 1989 ; |
|
High-performance liquid chromatographic separations of stereoisomers of chiral basic agrochemicals with polysaccharide-based chiral columns and polar organic mobile phases.
J. Sep. Sci. 38 , 4173-9, (2016) The separation of the stereoisomers of 23 chiral basic agrochemicals was studied on six different polysaccharide-based chiral columns in high-performance liquid chromatography with various polar organ... |
|
|
Multi-azole-resistant Aspergillus fumigatus in the environment in Tanzania.
J. Antimicrob. Chemother. 69(11) , 2979-83, (2014) Azole resistance in Aspergillus fumigatus isolates has been increasingly reported with variable prevalence worldwide and is challenging the effective management of aspergillosis. Here we report the co... |
| Metconazole |
| 1RS,5SR)-5-(4-chlorobenzyl)-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
| 5-[(4-chlorophenyl)methyl]-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentanol |
| 5-[(4-chlorophenyl)methyl]-2,2-dimethyl-1-(1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol |
| (1Ξ,5Ξ)-5-[(4-chlorophenyl)methyl]-2,2-dimethyl-1-(1H-1,2,4-triazol-1-ylmethyl)cyclopentan-1-ol |
| (1RS,5RS |