5-cyclobutyl-5-phenylhydantoin structure
|
Common Name | 5-cyclobutyl-5-phenylhydantoin | ||
|---|---|---|---|---|
| CAS Number | 125650-44-4 | Molecular Weight | 230.26200 | |
| Density | 1.272g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O2 | Melting Point | 234-235°C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-cyclobutyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.272g/cm3 |
|---|---|
| Melting Point | 234-235°C |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.26200 |
| Exact Mass | 230.10600 |
| PSA | 58.20000 |
| LogP | 2.17900 |
| Index of Refraction | 1.596 |
| InChIKey | YFMSPNSDLBGLRF-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C(c2ccccc2)(C2CCC2)N1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
| Safety Phrases | S26-S37/39 |
| WGK Germany | 3 |
| HS Code | 2933990090 |
|
~%
5-cyclobutyl-5-... CAS#:125650-44-4 |
| Literature: Journal of the American Chemical Society, , vol. 74, p. 3615 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-cyclobutyl-5-phenyl-imidazolidine-2,4-dione |
| MFCD00022395 |
| 5-Cyclobutyl-5-phenyl-imidazolidin-2,4-dion |
| 5-CYCLOBUTYL-5-PHENYLHYDANTOIN |